C19H16Cl3NO4 — CID 19227052
ethyl 5-chloro-4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-2-methoxybenzoate (PubChem CID 19227052) has the molecular formula C19H16Cl3NO4 and a molecular weight of 428.70 g/mol. Its IUPAC name is ethyl 5-chloro-4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-2-methoxybenzoate.
| Compound Name | ethyl 5-chloro-4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 19227052 |
| Molecular Formula | C19H16Cl3NO4 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | ethyl 5-chloro-4-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]-2-methoxybenzoate |
| SMILES | CCOC(=O)c1cc(Cl)c(NC(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H16Cl3NO4/c1-3-27-19(25)12-9-15(22)16(10-17(12)26-2)23-18(24)7-5-11-4-6-13(20)14(21)8-11/h4-10H,3H2,1-2H3,(H,23,24)/b7-5+ |
| InChIKey | QQYXXHYAIWGELD-FNORWQNLSA-N |
| XLogP | 5.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|