C18H15Cl2NO3 — CID 4152115
ethyl 4-[3-(3,4-dichlorophenyl)prop-2-enoylamino]benzoate (PubChem CID 4152115) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is ethyl 4-[3-(3,4-dichlorophenyl)prop-2-enoylamino]benzoate.
| Compound Name | ethyl 4-[3-(3,4-dichlorophenyl)prop-2-enoylamino]benzoate |
|---|---|
| PubChem CID | 4152115 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | ethyl 4-[3-(3,4-dichlorophenyl)prop-2-enoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C=Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H15Cl2NO3/c1-2-24-18(23)13-5-7-14(8-6-13)21-17(22)10-4-12-3-9-15(19)16(20)11-12/h3-11H,2H2,1H3,(H,21,22) |
| InChIKey | LTYCRWDXHUGYNY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|