C22H28N2O5S — CID 19171599
ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 19171599) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 19171599 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | ethyl 2-[[(E)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCOc1ccc(/C=C/C(=O)Nc2nc(C)c(C(=O)OCC)s2)cc1OC |
| InChI | InChI=1S/C22H28N2O5S/c1-5-7-8-13-29-17-11-9-16(14-18(17)27-4)10-12-19(25)24-22-23-15(3)20(30-22)21(26)28-6-2/h9-12,14H,5-8,13H2,1-4H3,(H,23,24,25)/b12-10+ |
| InChIKey | SFVRUZBDLLMGEX-ZRDIBKRKSA-N |
| XLogP | 4.86 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|