C20H24N2O4S — CID 5189387
ethyl 2-[3-(2-butoxyphenyl)prop-2-enoylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 5189387) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is ethyl 2-[3-(2-butoxyphenyl)prop-2-enoylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[3-(2-butoxyphenyl)prop-2-enoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 5189387 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | ethyl 2-[3-(2-butoxyphenyl)prop-2-enoylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCOc1ccccc1C=CC(=O)Nc1nc(C)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C20H24N2O4S/c1-4-6-13-26-16-10-8-7-9-15(16)11-12-17(23)22-20-21-14(3)18(27-20)19(24)25-5-2/h7-12H,4-6,13H2,1-3H3,(H,21,22,23) |
| InChIKey | WZIRAKGNTTYKIX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|