C22H25NO6S — CID 19207576
diethyl 5-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19207576) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is diethyl 5-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19207576 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | diethyl 5-[[(E)-3-(2-ethoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)/C=C/c2ccccc2OCC)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C22H25NO6S/c1-5-27-16-11-9-8-10-15(16)12-13-17(24)23-20-18(21(25)28-6-2)14(4)19(30-20)22(26)29-7-3/h8-13H,5-7H2,1-4H3,(H,23,24)/b13-12+ |
| InChIKey | RCWHOAQQEQUJFF-OUKQBFOZSA-N |
| XLogP | 4.46 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|