C20H19BrN2O4S — CID 4199458
ethyl 5-[3-(5-bromo-2-ethoxyphenyl)prop-2-enoylamino]-4-cyano-3-methylthiophene-2-carboxylate (PubChem CID 4199458) has the molecular formula C20H19BrN2O4S and a molecular weight of 463.35 g/mol. Its IUPAC name is ethyl 5-[3-(5-bromo-2-ethoxyphenyl)prop-2-enoylamino]-4-cyano-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[3-(5-bromo-2-ethoxyphenyl)prop-2-enoylamino]-4-cyano-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4199458 |
| Molecular Formula | C20H19BrN2O4S |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | ethyl 5-[3-(5-bromo-2-ethoxyphenyl)prop-2-enoylamino]-4-cyano-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C=Cc2cc(Br)ccc2OCC)c(C#N)c1C |
| InChI | InChI=1S/C20H19BrN2O4S/c1-4-26-16-8-7-14(21)10-13(16)6-9-17(24)23-19-15(11-22)12(3)18(28-19)20(25)27-5-2/h6-10H,4-5H2,1-3H3,(H,23,24) |
| InChIKey | HQRUDJYYYMFDAH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_D(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|