C19H16Cl2N2O4S — CID 1397342
ethyl 4-cyano-5-[3-(3,5-dichloro-2-methoxyphenyl)prop-2-enoylamino]-3-methylthiophene-2-carboxylate (PubChem CID 1397342) has the molecular formula C19H16Cl2N2O4S and a molecular weight of 439.32 g/mol. Its IUPAC name is ethyl 4-cyano-5-[3-(3,5-dichloro-2-methoxyphenyl)prop-2-enoylamino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-[3-(3,5-dichloro-2-methoxyphenyl)prop-2-enoylamino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 1397342 |
| Molecular Formula | C19H16Cl2N2O4S |
| Molecular Weight | 439.32 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | ethyl 4-cyano-5-[3-(3,5-dichloro-2-methoxyphenyl)prop-2-enoylamino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C=Cc2cc(Cl)cc(Cl)c2OC)c(C#N)c1C |
| InChI | InChI=1S/C19H16Cl2N2O4S/c1-4-27-19(25)17-10(2)13(9-22)18(28-17)23-15(24)6-5-11-7-12(20)8-14(21)16(11)26-3/h5-8H,4H2,1-3H3,(H,23,24) |
| InChIKey | JFFZBJHSAPMGJG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_D(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|