C16H14N2O3S2 — CID 5220671
ethyl 4-cyano-3-methyl-5-(3-thiophen-2-ylprop-2-enoylamino)thiophene-2-carboxylate (PubChem CID 5220671) has the molecular formula C16H14N2O3S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl 4-cyano-3-methyl-5-(3-thiophen-2-ylprop-2-enoylamino)thiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-methyl-5-(3-thiophen-2-ylprop-2-enoylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 5220671 |
| Molecular Formula | C16H14N2O3S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | ethyl 4-cyano-3-methyl-5-(3-thiophen-2-ylprop-2-enoylamino)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C=Cc2cccs2)c(C#N)c1C |
| InChI | InChI=1S/C16H14N2O3S2/c1-3-21-16(20)14-10(2)12(9-17)15(23-14)18-13(19)7-6-11-5-4-8-22-11/h4-8H,3H2,1-2H3,(H,18,19) |
| InChIKey | BLAGPSYBYKTZAS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_D(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|