C18H15Br2N3O4S2 — CID 17314592
ethyl 4-cyano-5-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]-3-methylthiophene-2-carboxylate (PubChem CID 17314592) has the molecular formula C18H15Br2N3O4S2 and a molecular weight of 561.28 g/mol. Its IUPAC name is ethyl 4-cyano-5-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-5-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 17314592 |
| Molecular Formula | C18H15Br2N3O4S2 |
| Molecular Weight | 561.28 g/mol |
| Exact Mass | 558.89 |
| IUPAC Name | ethyl 4-cyano-5-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)c2cc(Br)cc(Br)c2OC)c(C#N)c1C |
| InChI | InChI=1S/C18H15Br2N3O4S2/c1-4-27-17(25)14-8(2)11(7-21)16(29-14)23-18(28)22-15(24)10-5-9(19)6-12(20)13(10)26-3/h5-6H,4H2,1-3H3,(H2,22,23,24,28) |
| InChIKey | AMTJRPOOMPKUBQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.28 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|