C18H17Br2N3O3S2 — CID 17314595
2-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17314595) has the molecular formula C18H17Br2N3O3S2 and a molecular weight of 547.29 g/mol. Its IUPAC name is 2-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17314595 |
| Molecular Formula | C18H17Br2N3O3S2 |
| Molecular Weight | 547.29 g/mol |
| Exact Mass | 544.91 |
| IUPAC Name | 2-[(3,5-dibromo-2-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)NC(=S)Nc1sc2c(c1C(N)=O)CCCC2 |
| InChI | InChI=1S/C18H17Br2N3O3S2/c1-26-14-10(6-8(19)7-11(14)20)16(25)22-18(27)23-17-13(15(21)24)9-4-2-3-5-12(9)28-17/h6-7H,2-5H2,1H3,(H2,21,24)(H2,22,23,25,27) |
| InChIKey | QIEFNECBIVCPOD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|