C17H16BrN3O3S2 — CID 4504706
2-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 4504706) has the molecular formula C17H16BrN3O3S2 and a molecular weight of 454.37 g/mol. Its IUPAC name is 2-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4504706 |
| Molecular Formula | C17H16BrN3O3S2 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 452.98 |
| IUPAC Name | 2-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2sc3c(c2C(N)=O)CCC3)cc1Br |
| InChI | InChI=1S/C17H16BrN3O3S2/c1-24-11-6-5-8(7-10(11)18)15(23)20-17(25)21-16-13(14(19)22)9-3-2-4-12(9)26-16/h5-7H,2-4H2,1H3,(H2,19,22)(H2,20,21,23,25) |
| InChIKey | WKPJUKUZUBKLFL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|