C19H20BrN3O3S2 — CID 30581837
(6S)-2-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 30581837) has the molecular formula C19H20BrN3O3S2 and a molecular weight of 482.43 g/mol. Its IUPAC name is (6S)-2-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-2-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 30581837 |
| Molecular Formula | C19H20BrN3O3S2 |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | (6S)-2-[(3-bromo-4-methoxybenzoyl)carbamothioylamino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2sc3c(c2C(N)=O)CC[C@H](C)C3)cc1Br |
| InChI | InChI=1S/C19H20BrN3O3S2/c1-9-3-5-11-14(7-9)28-18(15(11)16(21)24)23-19(27)22-17(25)10-4-6-13(26-2)12(20)8-10/h4,6,8-9H,3,5,7H2,1-2H3,(H2,21,24)(H2,22,23,25,27)/t9-/m0/s1 |
| InChIKey | SCHYLOAHBHUXTM-VIFPVBQESA-N |
| XLogP | 3.87 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|