C19H21N3O2S2 — CID 1396218
(6R)-6-methyl-2-[(3-methylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 1396218) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is (6R)-6-methyl-2-[(3-methylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-methyl-2-[(3-methylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 1396218 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | (6R)-6-methyl-2-[(3-methylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cccc(C(=O)NC(=S)Nc2sc3c(c2C(N)=O)CC[C@@H](C)C3)c1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-10-4-3-5-12(8-10)17(24)21-19(25)22-18-15(16(20)23)13-7-6-11(2)9-14(13)26-18/h3-5,8,11H,6-7,9H2,1-2H3,(H2,20,23)(H2,21,22,24,25)/t11-/m1/s1 |
| InChIKey | YZOLCXGNYQYVRB-LLVKDONJSA-N |
| XLogP | 3.41 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|