C25H24BrN3O3S2 — CID 17072994
2-[[3-bromo-4-(2-phenylethoxy)benzoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17072994) has the molecular formula C25H24BrN3O3S2 and a molecular weight of 558.52 g/mol. Its IUPAC name is 2-[[3-bromo-4-(2-phenylethoxy)benzoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[3-bromo-4-(2-phenylethoxy)benzoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17072994 |
| Molecular Formula | C25H24BrN3O3S2 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 557.04 |
| IUPAC Name | 2-[[3-bromo-4-(2-phenylethoxy)benzoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=S)NC(=O)c2ccc(OCCc3ccccc3)c(Br)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C25H24BrN3O3S2/c26-18-14-16(10-11-19(18)32-13-12-15-6-2-1-3-7-15)23(31)28-25(33)29-24-21(22(27)30)17-8-4-5-9-20(17)34-24/h1-3,6-7,10-11,14H,4-5,8-9,12-13H2,(H2,27,30)(H2,28,29,31,33) |
| InChIKey | FPGHNAUNQDWAAA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|