C25H31BrN2O4S2 — CID 4959751
ethyl 2-[(3-bromo-4-hexoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4959751) has the molecular formula C25H31BrN2O4S2 and a molecular weight of 567.57 g/mol. Its IUPAC name is ethyl 2-[(3-bromo-4-hexoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-bromo-4-hexoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4959751 |
| Molecular Formula | C25H31BrN2O4S2 |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | ethyl 2-[(3-bromo-4-hexoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2sc3c(c2C(=O)OCC)CCCC3)cc1Br |
| InChI | InChI=1S/C25H31BrN2O4S2/c1-3-5-6-9-14-32-19-13-12-16(15-18(19)26)22(29)27-25(33)28-23-21(24(30)31-4-2)17-10-7-8-11-20(17)34-23/h12-13,15H,3-11,14H2,1-2H3,(H2,27,28,29,33) |
| InChIKey | YWFXXLFKNWFROG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|