C20H22N2O4S2 — CID 1420371
ethyl 2-[(4-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 1420371) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is ethyl 2-[(4-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 1420371 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | ethyl 2-[(4-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2ccc(OC)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C20H22N2O4S2/c1-3-26-19(24)16-14-6-4-5-7-15(14)28-18(16)22-20(27)21-17(23)12-8-10-13(25-2)11-9-12/h8-11H,3-7H2,1-2H3,(H2,21,22,23,27) |
| InChIKey | HPKSDAJQAMBEHL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|