C22H26N2O5S2 — CID 17353743
ethyl 2-[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17353743) has the molecular formula C22H26N2O5S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is ethyl 2-[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17353743 |
| Molecular Formula | C22H26N2O5S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | ethyl 2-[[4-(2-methoxyethoxy)benzoyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2ccc(OCCOC)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C22H26N2O5S2/c1-3-28-21(26)18-16-6-4-5-7-17(16)31-20(18)24-22(30)23-19(25)14-8-10-15(11-9-14)29-13-12-27-2/h8-11H,3-7,12-13H2,1-2H3,(H2,23,24,25,30) |
| InChIKey | LGXHCMCLZNLOGD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|