C20H21ClN2O4S2 — CID 1336952
ethyl 2-[(5-chloro-2-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 1336952) has the molecular formula C20H21ClN2O4S2 and a molecular weight of 452.99 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-2-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-chloro-2-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 1336952 |
| Molecular Formula | C20H21ClN2O4S2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | ethyl 2-[(5-chloro-2-methoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=S)NC(=O)c2cc(Cl)ccc2OC)sc2c1CCCC2 |
| InChI | InChI=1S/C20H21ClN2O4S2/c1-3-27-19(25)16-12-6-4-5-7-15(12)29-18(16)23-20(28)22-17(24)13-10-11(21)8-9-14(13)26-2/h8-10H,3-7H2,1-2H3,(H2,22,23,24,28) |
| InChIKey | OFLUDLRIWHZYRG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|