C18H17BrN2O4S2 — CID 17094468
methyl 2-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 17094468) has the molecular formula C18H17BrN2O4S2 and a molecular weight of 469.38 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17094468 |
| Molecular Formula | C18H17BrN2O4S2 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | methyl 2-[(5-bromo-2-methoxybenzoyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NC(=O)c2cc(Br)ccc2OC)sc2c1CCC2 |
| InChI | InChI=1S/C18H17BrN2O4S2/c1-24-12-7-6-9(19)8-11(12)15(22)20-18(26)21-16-14(17(23)25-2)10-4-3-5-13(10)27-16/h6-8H,3-5H2,1-2H3,(H2,20,21,22,26) |
| InChIKey | RMBBTYRDEUDOJN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|