C21H23BrN2O4S2 — CID 17342999
methyl 2-[(3-bromo-4-propoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 17342999) has the molecular formula C21H23BrN2O4S2 and a molecular weight of 511.46 g/mol. Its IUPAC name is methyl 2-[(3-bromo-4-propoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-bromo-4-propoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 17342999 |
| Molecular Formula | C21H23BrN2O4S2 |
| Molecular Weight | 511.46 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | methyl 2-[(3-bromo-4-propoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2sc3c(c2C(=O)OC)CCCC3)cc1Br |
| InChI | InChI=1S/C21H23BrN2O4S2/c1-3-10-28-15-9-8-12(11-14(15)22)18(25)23-21(29)24-19-17(20(26)27-2)13-6-4-5-7-16(13)30-19/h8-9,11H,3-7,10H2,1-2H3,(H2,23,24,25,29) |
| InChIKey | YMXBGMLZYMZBGR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|