C22H25BrN2O3S2 — CID 5120415
methyl 2-[(3-bromo-4-tert-butylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5120415) has the molecular formula C22H25BrN2O3S2 and a molecular weight of 509.49 g/mol. Its IUPAC name is methyl 2-[(3-bromo-4-tert-butylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[(3-bromo-4-tert-butylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5120415 |
| Molecular Formula | C22H25BrN2O3S2 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | methyl 2-[(3-bromo-4-tert-butylbenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NC(=O)c2ccc(C(C)(C)C)c(Br)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C22H25BrN2O3S2/c1-22(2,3)14-10-9-12(11-15(14)23)18(26)24-21(29)25-19-17(20(27)28-4)13-7-5-6-8-16(13)30-19/h9-11H,5-8H2,1-4H3,(H2,24,25,26,29) |
| InChIKey | VRJHYGBXYFANDE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|