C20H22BrN3O3S2 — CID 17343005
2-[(3-bromo-4-propoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 17343005) has the molecular formula C20H22BrN3O3S2 and a molecular weight of 496.45 g/mol. Its IUPAC name is 2-[(3-bromo-4-propoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(3-bromo-4-propoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 17343005 |
| Molecular Formula | C20H22BrN3O3S2 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 2-[(3-bromo-4-propoxybenzoyl)carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2sc3c(c2C(N)=O)CCCC3)cc1Br |
| InChI | InChI=1S/C20H22BrN3O3S2/c1-2-9-27-14-8-7-11(10-13(14)21)18(26)23-20(28)24-19-16(17(22)25)12-5-3-4-6-15(12)29-19/h7-8,10H,2-6,9H2,1H3,(H2,22,25)(H2,23,24,26,28) |
| InChIKey | RQALQPJPNKHJHI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|