C25H26BrN3O3S2 — CID 4956070
5-benzyl-2-[(3-bromo-4-butoxybenzoyl)carbamothioylamino]-4-methylthiophene-3-carboxamide (PubChem CID 4956070) has the molecular formula C25H26BrN3O3S2 and a molecular weight of 560.54 g/mol. Its IUPAC name is 5-benzyl-2-[(3-bromo-4-butoxybenzoyl)carbamothioylamino]-4-methylthiophene-3-carboxamide.
| Compound Name | 5-benzyl-2-[(3-bromo-4-butoxybenzoyl)carbamothioylamino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 4956070 |
| Molecular Formula | C25H26BrN3O3S2 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | 5-benzyl-2-[(3-bromo-4-butoxybenzoyl)carbamothioylamino]-4-methylthiophene-3-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2sc(Cc3ccccc3)c(C)c2C(N)=O)cc1Br |
| InChI | InChI=1S/C25H26BrN3O3S2/c1-3-4-12-32-19-11-10-17(14-18(19)26)23(31)28-25(33)29-24-21(22(27)30)15(2)20(34-24)13-16-8-6-5-7-9-16/h5-11,14H,3-4,12-13H2,1-2H3,(H2,27,30)(H2,28,29,31,33) |
| InChIKey | ADELDZFHJJWTGF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|