C21H18BrN3O2S2 — CID 54791757
5-benzyl-2-[(3-bromobenzoyl)carbamothioylamino]-4-methylthiophene-3-carboxamide (PubChem CID 54791757) has the molecular formula C21H18BrN3O2S2 and a molecular weight of 488.43 g/mol. Its IUPAC name is 5-benzyl-2-[(3-bromobenzoyl)carbamothioylamino]-4-methylthiophene-3-carboxamide.
| Compound Name | 5-benzyl-2-[(3-bromobenzoyl)carbamothioylamino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 54791757 |
| Molecular Formula | C21H18BrN3O2S2 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | 5-benzyl-2-[(3-bromobenzoyl)carbamothioylamino]-4-methylthiophene-3-carboxamide |
| SMILES | Cc1c(Cc2ccccc2)sc(NC(=S)NC(=O)c2cccc(Br)c2)c1C(N)=O |
| InChI | InChI=1S/C21H18BrN3O2S2/c1-12-16(10-13-6-3-2-4-7-13)29-20(17(12)18(23)26)25-21(28)24-19(27)14-8-5-9-15(22)11-14/h2-9,11H,10H2,1H3,(H2,23,26)(H2,24,25,27,28) |
| InChIKey | FMVWNKPUDJFJAU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|