C23H20ClN3O2S2 — CID 4509123
5-benzyl-2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-4-methylthiophene-3-carboxamide (PubChem CID 4509123) has the molecular formula C23H20ClN3O2S2 and a molecular weight of 470.02 g/mol. Its IUPAC name is 5-benzyl-2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-4-methylthiophene-3-carboxamide.
| Compound Name | 5-benzyl-2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 4509123 |
| Molecular Formula | C23H20ClN3O2S2 |
| Molecular Weight | 470.02 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 5-benzyl-2-[3-(2-chlorophenyl)prop-2-enoylcarbamothioylamino]-4-methylthiophene-3-carboxamide |
| SMILES | Cc1c(Cc2ccccc2)sc(NC(=S)NC(=O)C=Cc2ccccc2Cl)c1C(N)=O |
| InChI | InChI=1S/C23H20ClN3O2S2/c1-14-18(13-15-7-3-2-4-8-15)31-22(20(14)21(25)29)27-23(30)26-19(28)12-11-16-9-5-6-10-17(16)24/h2-12H,13H2,1H3,(H2,25,29)(H2,26,27,28,30) |
| InChIKey | NYJMUQWEBSKVLA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.02 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|