C23H23N3O3S2 — CID 4636123
5-benzyl-4-methyl-2-[[2-(2-methylphenoxy)acetyl]carbamothioylamino]thiophene-3-carboxamide (PubChem CID 4636123) has the molecular formula C23H23N3O3S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 5-benzyl-4-methyl-2-[[2-(2-methylphenoxy)acetyl]carbamothioylamino]thiophene-3-carboxamide.
| Compound Name | 5-benzyl-4-methyl-2-[[2-(2-methylphenoxy)acetyl]carbamothioylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 4636123 |
| Molecular Formula | C23H23N3O3S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 5-benzyl-4-methyl-2-[[2-(2-methylphenoxy)acetyl]carbamothioylamino]thiophene-3-carboxamide |
| SMILES | Cc1ccccc1OCC(=O)NC(=S)Nc1sc(Cc2ccccc2)c(C)c1C(N)=O |
| InChI | InChI=1S/C23H23N3O3S2/c1-14-8-6-7-11-17(14)29-13-19(27)25-23(30)26-22-20(21(24)28)15(2)18(31-22)12-16-9-4-3-5-10-16/h3-11H,12-13H2,1-2H3,(H2,24,28)(H2,25,26,27,30) |
| InChIKey | JEBOLIXBQAFODJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|