C22H20N4O5S2 — CID 3356545
5-benzyl-4-methyl-2-[[2-(4-nitrophenoxy)acetyl]carbamothioylamino]thiophene-3-carboxamide (PubChem CID 3356545) has the molecular formula C22H20N4O5S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 5-benzyl-4-methyl-2-[[2-(4-nitrophenoxy)acetyl]carbamothioylamino]thiophene-3-carboxamide.
| Compound Name | 5-benzyl-4-methyl-2-[[2-(4-nitrophenoxy)acetyl]carbamothioylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3356545 |
| Molecular Formula | C22H20N4O5S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 5-benzyl-4-methyl-2-[[2-(4-nitrophenoxy)acetyl]carbamothioylamino]thiophene-3-carboxamide |
| SMILES | Cc1c(Cc2ccccc2)sc(NC(=S)NC(=O)COc2ccc([N+](=O)[O-])cc2)c1C(N)=O |
| InChI | InChI=1S/C22H20N4O5S2/c1-13-17(11-14-5-3-2-4-6-14)33-21(19(13)20(23)28)25-22(32)24-18(27)12-31-16-9-7-15(8-10-16)26(29)30/h2-10H,11-12H2,1H3,(H2,23,28)(H2,24,25,27,32) |
| InChIKey | GIYLCRAOIUXKNG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|