C19H17N3O3S2 — CID 4631871
N-[(5-benzyl-3-carbamoyl-4-methylthiophen-2-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 4631871) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[(5-benzyl-3-carbamoyl-4-methylthiophen-2-yl)carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[(5-benzyl-3-carbamoyl-4-methylthiophen-2-yl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4631871 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | N-[(5-benzyl-3-carbamoyl-4-methylthiophen-2-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1c(Cc2ccccc2)sc(NC(=S)NC(=O)c2ccco2)c1C(N)=O |
| InChI | InChI=1S/C19H17N3O3S2/c1-11-14(10-12-6-3-2-4-7-12)27-18(15(11)16(20)23)22-19(26)21-17(24)13-8-5-9-25-13/h2-9H,10H2,1H3,(H2,20,23)(H2,21,22,24,26) |
| InChIKey | MCQVLKCYZWBQMS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|