C24H20ClN3O3S3 — CID 3401255
N-[(5-benzyl-3-carbamoyl-4-methylthiophen-2-yl)carbamothioyl]-3-chloro-6-methoxy-1-benzothiophene-2-carboxamide (PubChem CID 3401255) has the molecular formula C24H20ClN3O3S3 and a molecular weight of 530.10 g/mol. Its IUPAC name is N-[(5-benzyl-3-carbamoyl-4-methylthiophen-2-yl)carbamothioyl]-3-chloro-6-methoxy-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(5-benzyl-3-carbamoyl-4-methylthiophen-2-yl)carbamothioyl]-3-chloro-6-methoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3401255 |
| Molecular Formula | C24H20ClN3O3S3 |
| Molecular Weight | 530.10 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | N-[(5-benzyl-3-carbamoyl-4-methylthiophen-2-yl)carbamothioyl]-3-chloro-6-methoxy-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2c(Cl)c(C(=O)NC(=S)Nc3sc(Cc4ccccc4)c(C)c3C(N)=O)sc2c1 |
| InChI | InChI=1S/C24H20ClN3O3S3/c1-12-16(10-13-6-4-3-5-7-13)34-23(18(12)21(26)29)28-24(32)27-22(30)20-19(25)15-9-8-14(31-2)11-17(15)33-20/h3-9,11H,10H2,1-2H3,(H2,26,29)(H2,27,28,30,32) |
| InChIKey | OHZXZUIBCXJBTR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.10 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|