C26H23N3O3S2 — CID 3394757
5-benzyl-4-methyl-2-[(2-naphthalen-1-yloxyacetyl)carbamothioylamino]thiophene-3-carboxamide (PubChem CID 3394757) has the molecular formula C26H23N3O3S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 5-benzyl-4-methyl-2-[(2-naphthalen-1-yloxyacetyl)carbamothioylamino]thiophene-3-carboxamide.
| Compound Name | 5-benzyl-4-methyl-2-[(2-naphthalen-1-yloxyacetyl)carbamothioylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3394757 |
| Molecular Formula | C26H23N3O3S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 5-benzyl-4-methyl-2-[(2-naphthalen-1-yloxyacetyl)carbamothioylamino]thiophene-3-carboxamide |
| SMILES | Cc1c(Cc2ccccc2)sc(NC(=S)NC(=O)COc2cccc3ccccc23)c1C(N)=O |
| InChI | InChI=1S/C26H23N3O3S2/c1-16-21(14-17-8-3-2-4-9-17)34-25(23(16)24(27)31)29-26(33)28-22(30)15-32-20-13-7-11-18-10-5-6-12-19(18)20/h2-13H,14-15H2,1H3,(H2,27,31)(H2,28,29,30,33) |
| InChIKey | IXRZBHCIZNGCRF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|