C18H21N3O3S2 — CID 4659091
2-[[2-(4-ethylphenoxy)acetyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 4659091) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-[[2-(4-ethylphenoxy)acetyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-[[2-(4-ethylphenoxy)acetyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 4659091 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[[2-(4-ethylphenoxy)acetyl]carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | CCc1ccc(OCC(=O)NC(=S)Nc2sc(C)c(C)c2C(N)=O)cc1 |
| InChI | InChI=1S/C18H21N3O3S2/c1-4-12-5-7-13(8-6-12)24-9-14(22)20-18(25)21-17-15(16(19)23)10(2)11(3)26-17/h5-8H,4,9H2,1-3H3,(H2,19,23)(H2,20,21,22,25) |
| InChIKey | BWOYKHNWHLQWTA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|