C19H23N3O3S2 — CID 4936611
2-[(4-butoxybenzoyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide (PubChem CID 4936611) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-[(4-butoxybenzoyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | 2-[(4-butoxybenzoyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 4936611 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-[(4-butoxybenzoyl)carbamothioylamino]-4,5-dimethylthiophene-3-carboxamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2sc(C)c(C)c2C(N)=O)cc1 |
| InChI | InChI=1S/C19H23N3O3S2/c1-4-5-10-25-14-8-6-13(7-9-14)17(24)21-19(26)22-18-15(16(20)23)11(2)12(3)27-18/h6-9H,4-5,10H2,1-3H3,(H2,20,23)(H2,21,22,24,26) |
| InChIKey | GKXJQFAIDMWEKF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|