C18H19N3O4S2 — CID 17178663
methyl 4-[(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)carbamothioylcarbamoyl]benzoate (PubChem CID 17178663) has the molecular formula C18H19N3O4S2 and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl 4-[(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 4-[(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17178663 |
| Molecular Formula | C18H19N3O4S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | methyl 4-[(3-carbamoyl-4-ethyl-5-methylthiophen-2-yl)carbamothioylcarbamoyl]benzoate |
| SMILES | CCc1c(C)sc(NC(=S)NC(=O)c2ccc(C(=O)OC)cc2)c1C(N)=O |
| InChI | InChI=1S/C18H19N3O4S2/c1-4-12-9(2)27-16(13(12)14(19)22)21-18(26)20-15(23)10-5-7-11(8-6-10)17(24)25-3/h5-8H,4H2,1-3H3,(H2,19,22)(H2,20,21,23,26) |
| InChIKey | AHMKPLNJLOVHRC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|