C12H15N5O2S2 — CID 19687045
methyl 4-ethyl-5-methyl-2-(1,2,4-triazol-4-ylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 19687045) has the molecular formula C12H15N5O2S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is methyl 4-ethyl-5-methyl-2-(1,2,4-triazol-4-ylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-ethyl-5-methyl-2-(1,2,4-triazol-4-ylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19687045 |
| Molecular Formula | C12H15N5O2S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | methyl 4-ethyl-5-methyl-2-(1,2,4-triazol-4-ylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=S)Nn2cnnc2)c1C(=O)OC |
| InChI | InChI=1S/C12H15N5O2S2/c1-4-8-7(2)21-10(9(8)11(18)19-3)15-12(20)16-17-5-13-14-6-17/h5-6H,4H2,1-3H3,(H2,15,16,20) |
| InChIKey | JCHNFFHODCKCPT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|