C17H26N2O2S2 — CID 40576434
methyl 2-[[(2R,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 40576434) has the molecular formula C17H26N2O2S2 and a molecular weight of 354.54 g/mol. Its IUPAC name is methyl 2-[[(2R,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(2R,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 40576434 |
| Molecular Formula | C17H26N2O2S2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | methyl 2-[[(2R,6R)-2,6-dimethylpiperidine-1-carbothioyl]amino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=S)N2[C@H](C)CCC[C@H]2C)c1C(=O)OC |
| InChI | InChI=1S/C17H26N2O2S2/c1-6-13-12(4)23-15(14(13)16(20)21-5)18-17(22)19-10(2)8-7-9-11(19)3/h10-11H,6-9H2,1-5H3,(H,18,22)/t10-,11-/m1/s1 |
| InChIKey | ADPHLHFQCWEVEQ-GHMZBOCLSA-N |
| XLogP | 4.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|