C18H19BrClN3O4S2 — CID 5186933
methyl 2-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate (PubChem CID 5186933) has the molecular formula C18H19BrClN3O4S2 and a molecular weight of 520.86 g/mol. Its IUPAC name is methyl 2-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5186933 |
| Molecular Formula | C18H19BrClN3O4S2 |
| Molecular Weight | 520.86 g/mol |
| Exact Mass | 518.97 |
| IUPAC Name | methyl 2-[[[2-(4-bromo-2-chlorophenoxy)acetyl]amino]carbamothioylamino]-4-ethyl-5-methylthiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=S)NNC(=O)COc2ccc(Br)cc2Cl)c1C(=O)OC |
| InChI | InChI=1S/C18H19BrClN3O4S2/c1-4-11-9(2)29-16(15(11)17(25)26-3)21-18(28)23-22-14(24)8-27-13-6-5-10(19)7-12(13)20/h5-7H,4,8H2,1-3H3,(H,22,24)(H2,21,23,28) |
| InChIKey | DQJIFRSGDRSDCR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|