C18H17BrClN3O5S — CID 3293723
2-(4-bromo-2-chlorophenoxy)-N-[[[2-(2-methoxyphenoxy)acetyl]amino]carbamothioyl]acetamide (PubChem CID 3293723) has the molecular formula C18H17BrClN3O5S and a molecular weight of 502.77 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenoxy)-N-[[[2-(2-methoxyphenoxy)acetyl]amino]carbamothioyl]acetamide.
| Compound Name | 2-(4-bromo-2-chlorophenoxy)-N-[[[2-(2-methoxyphenoxy)acetyl]amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3293723 |
| Molecular Formula | C18H17BrClN3O5S |
| Molecular Weight | 502.77 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | 2-(4-bromo-2-chlorophenoxy)-N-[[[2-(2-methoxyphenoxy)acetyl]amino]carbamothioyl]acetamide |
| SMILES | COc1ccccc1OCC(=O)NNC(=S)NC(=O)COc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C18H17BrClN3O5S/c1-26-14-4-2-3-5-15(14)28-10-17(25)22-23-18(29)21-16(24)9-27-13-7-6-11(19)8-12(13)20/h2-8H,9-10H2,1H3,(H,22,25)(H2,21,23,24,29) |
| InChIKey | SGXRQAZSLCXXOP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.77 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|