C23H25N3O3S3 — CID 2205118
methyl 4-ethyl-5-methyl-2-[[[5-methyl-4-(4-methylphenyl)thiophene-3-carbonyl]amino]carbamothioylamino]thiophene-3-carboxylate (PubChem CID 2205118) has the molecular formula C23H25N3O3S3 and a molecular weight of 487.67 g/mol. Its IUPAC name is methyl 4-ethyl-5-methyl-2-[[[5-methyl-4-(4-methylphenyl)thiophene-3-carbonyl]amino]carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4-ethyl-5-methyl-2-[[[5-methyl-4-(4-methylphenyl)thiophene-3-carbonyl]amino]carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2205118 |
| Molecular Formula | C23H25N3O3S3 |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | methyl 4-ethyl-5-methyl-2-[[[5-methyl-4-(4-methylphenyl)thiophene-3-carbonyl]amino]carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=S)NNC(=O)c2csc(C)c2-c2ccc(C)cc2)c1C(=O)OC |
| InChI | InChI=1S/C23H25N3O3S3/c1-6-16-13(3)32-21(19(16)22(28)29-5)24-23(30)26-25-20(27)17-11-31-14(4)18(17)15-9-7-12(2)8-10-15/h7-11H,6H2,1-5H3,(H,25,27)(H2,24,26,30) |
| InChIKey | YIDSARDJXIWKPO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|