C16H19N3O3S3 — CID 4509907
methyl 2-[[(4,5-dimethylthiophene-3-carbonyl)amino]carbamothioylamino]-5-ethylthiophene-3-carboxylate (PubChem CID 4509907) has the molecular formula C16H19N3O3S3 and a molecular weight of 397.55 g/mol. Its IUPAC name is methyl 2-[[(4,5-dimethylthiophene-3-carbonyl)amino]carbamothioylamino]-5-ethylthiophene-3-carboxylate.
| Compound Name | methyl 2-[[(4,5-dimethylthiophene-3-carbonyl)amino]carbamothioylamino]-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4509907 |
| Molecular Formula | C16H19N3O3S3 |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | methyl 2-[[(4,5-dimethylthiophene-3-carbonyl)amino]carbamothioylamino]-5-ethylthiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)NNC(=O)c2csc(C)c2C)s1 |
| InChI | InChI=1S/C16H19N3O3S3/c1-5-10-6-11(15(21)22-4)14(25-10)17-16(23)19-18-13(20)12-7-24-9(3)8(12)2/h6-7H,5H2,1-4H3,(H,18,20)(H2,17,19,23) |
| InChIKey | QCBVAINZNNABMF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|