C12H18N2O3S2 — CID 19652105
methyl 5-ethyl-2-(2-methoxyethylcarbamothioylamino)thiophene-3-carboxylate (PubChem CID 19652105) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is methyl 5-ethyl-2-(2-methoxyethylcarbamothioylamino)thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-(2-methoxyethylcarbamothioylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19652105 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | methyl 5-ethyl-2-(2-methoxyethylcarbamothioylamino)thiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)NCCOC)s1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-4-8-7-9(11(15)17-3)10(19-8)14-12(18)13-5-6-16-2/h7H,4-6H2,1-3H3,(H2,13,14,18) |
| InChIKey | DRPIAZAYPLTLGJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|