C18H20N2O2S2 — CID 19648917
methyl 2-(2,3-dihydro-1H-inden-5-ylcarbamothioylamino)-5-ethylthiophene-3-carboxylate (PubChem CID 19648917) has the molecular formula C18H20N2O2S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1H-inden-5-ylcarbamothioylamino)-5-ethylthiophene-3-carboxylate.
| Compound Name | methyl 2-(2,3-dihydro-1H-inden-5-ylcarbamothioylamino)-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19648917 |
| Molecular Formula | C18H20N2O2S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | methyl 2-(2,3-dihydro-1H-inden-5-ylcarbamothioylamino)-5-ethylthiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)Nc2ccc3c(c2)CCC3)s1 |
| InChI | InChI=1S/C18H20N2O2S2/c1-3-14-10-15(17(21)22-2)16(24-14)20-18(23)19-13-8-7-11-5-4-6-12(11)9-13/h7-10H,3-6H2,1-2H3,(H2,19,20,23) |
| InChIKey | IXZFIWAZVFDGCM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|