C16H17N3O4S2 — CID 2954389
methyl 5-ethyl-2-[(2-methyl-4-nitrophenyl)carbamothioylamino]thiophene-3-carboxylate (PubChem CID 2954389) has the molecular formula C16H17N3O4S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is methyl 5-ethyl-2-[(2-methyl-4-nitrophenyl)carbamothioylamino]thiophene-3-carboxylate.
| Compound Name | methyl 5-ethyl-2-[(2-methyl-4-nitrophenyl)carbamothioylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2954389 |
| Molecular Formula | C16H17N3O4S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | methyl 5-ethyl-2-[(2-methyl-4-nitrophenyl)carbamothioylamino]thiophene-3-carboxylate |
| SMILES | CCc1cc(C(=O)OC)c(NC(=S)Nc2ccc([N+](=O)[O-])cc2C)s1 |
| InChI | InChI=1S/C16H17N3O4S2/c1-4-11-8-12(15(20)23-3)14(25-11)18-16(24)17-13-6-5-10(19(21)22)7-9(13)2/h5-8H,4H2,1-3H3,(H2,17,18,24) |
| InChIKey | CNVQEBJIFRKKMI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|