C21H25N3O2S2 — CID 10216399
1-(2-methyl-4-nitrophenyl)-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea (PubChem CID 10216399) has the molecular formula C21H25N3O2S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-(2-methyl-4-nitrophenyl)-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea.
| Compound Name | 1-(2-methyl-4-nitrophenyl)-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea |
|---|---|
| PubChem CID | 10216399 |
| Molecular Formula | C21H25N3O2S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 1-(2-methyl-4-nitrophenyl)-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=S)Nc1ccc2c(c1)C(C)(C)CC(C)(C)S2 |
| InChI | InChI=1S/C21H25N3O2S2/c1-13-10-15(24(25)26)7-8-17(13)23-19(27)22-14-6-9-18-16(11-14)20(2,3)12-21(4,5)28-18/h6-11H,12H2,1-5H3,(H2,22,23,27) |
| InChIKey | CMVYAMQKLILTCP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|