C21H25N3OS2 — CID 146403621
1-benzamido-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea (PubChem CID 146403621) has the molecular formula C21H25N3OS2 and a molecular weight of 399.59 g/mol. Its IUPAC name is 1-benzamido-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea.
| Compound Name | 1-benzamido-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea |
|---|---|
| PubChem CID | 146403621 |
| Molecular Formula | C21H25N3OS2 |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-benzamido-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea |
| SMILES | CC1(C)CC(C)(C)c2cc(NC(=S)NNC(=O)c3ccccc3)ccc2S1 |
| InChI | InChI=1S/C21H25N3OS2/c1-20(2)13-21(3,4)27-17-11-10-15(12-16(17)20)22-19(26)24-23-18(25)14-8-6-5-7-9-14/h5-12H,13H2,1-4H3,(H,23,25)(H2,22,24,26) |
| InChIKey | BHOFKHZUHOTXBT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|