C22H25NOS — CID 170268189
(E)-3-phenyl-N-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-2-enamide (PubChem CID 170268189) has the molecular formula C22H25NOS and a molecular weight of 351.52 g/mol. Its IUPAC name is (E)-3-phenyl-N-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170268189 |
| Molecular Formula | C22H25NOS |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (E)-3-phenyl-N-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-2-enamide |
| SMILES | CC1(C)CC(C)(C)c2cc(NC(=O)/C=C/c3ccccc3)ccc2S1 |
| InChI | InChI=1S/C22H25NOS/c1-21(2)15-22(3,4)25-19-12-11-17(14-18(19)21)23-20(24)13-10-16-8-6-5-7-9-16/h5-14H,15H2,1-4H3,(H,23,24)/b13-10+ |
| InChIKey | FQGRYTSGCQAPQL-JLHYYAGUSA-N |
| XLogP | 5.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|