C22H24F3N3O2S2 — CID 146403638
1-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)-1-[[4-(trifluoromethoxy)benzoyl]amino]thiourea (PubChem CID 146403638) has the molecular formula C22H24F3N3O2S2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 1-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)-1-[[4-(trifluoromethoxy)benzoyl]amino]thiourea.
| Compound Name | 1-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)-1-[[4-(trifluoromethoxy)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 146403638 |
| Molecular Formula | C22H24F3N3O2S2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 1-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)-1-[[4-(trifluoromethoxy)benzoyl]amino]thiourea |
| SMILES | CC1(C)CC(C)(C)c2cc(N(NC(=O)c3ccc(OC(F)(F)F)cc3)C(N)=S)ccc2S1 |
| InChI | InChI=1S/C22H24F3N3O2S2/c1-20(2)12-21(3,4)32-17-10-7-14(11-16(17)20)28(19(26)31)27-18(29)13-5-8-15(9-6-13)30-22(23,24)25/h5-11H,12H2,1-4H3,(H2,26,31)(H,27,29) |
| InChIKey | SKDNZHCZLRPMAE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|