C21H15Cl2F3N4O2 — CID 54227532
1-[[C,N-bis(4-chlorophenyl)carbonimidoyl]amino]-1-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 54227532) has the molecular formula C21H15Cl2F3N4O2 and a molecular weight of 483.28 g/mol. Its IUPAC name is 1-[[C,N-bis(4-chlorophenyl)carbonimidoyl]amino]-1-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[[C,N-bis(4-chlorophenyl)carbonimidoyl]amino]-1-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 54227532 |
| Molecular Formula | C21H15Cl2F3N4O2 |
| Molecular Weight | 483.28 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 1-[[C,N-bis(4-chlorophenyl)carbonimidoyl]amino]-1-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | NC(=O)N(N/C(=N/c1ccc(Cl)cc1)c1ccc(Cl)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H15Cl2F3N4O2/c22-14-3-1-13(2-4-14)19(28-16-7-5-15(23)6-8-16)29-30(20(27)31)17-9-11-18(12-10-17)32-21(24,25)26/h1-12H,(H2,27,31)(H,28,29) |
| InChIKey | QGXPGZJUSKXSEF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.28 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|