C9H7F3N4O — CID 134398637
1-cyano-2-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 134398637) has the molecular formula C9H7F3N4O and a molecular weight of 244.18 g/mol. Its IUPAC name is 1-cyano-2-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 1-cyano-2-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 134398637 |
| Molecular Formula | C9H7F3N4O |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1-cyano-2-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N#CN/C(N)=N/c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7F3N4O/c10-9(11,12)17-7-3-1-6(2-4-7)16-8(14)15-5-13/h1-4H,(H3,14,15,16) |
| InChIKey | YMRUKVOMICGTDP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|