C16H12F3N3OS — CID 169363360
methyl N-cyano-N'-[2-[4-(trifluoromethoxy)phenyl]phenyl]carbamimidothioate (PubChem CID 169363360) has the molecular formula C16H12F3N3OS and a molecular weight of 351.35 g/mol. Its IUPAC name is methyl N-cyano-N'-[2-[4-(trifluoromethoxy)phenyl]phenyl]carbamimidothioate.
| Compound Name | methyl N-cyano-N'-[2-[4-(trifluoromethoxy)phenyl]phenyl]carbamimidothioate |
|---|---|
| PubChem CID | 169363360 |
| Molecular Formula | C16H12F3N3OS |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | methyl N-cyano-N'-[2-[4-(trifluoromethoxy)phenyl]phenyl]carbamimidothioate |
| SMILES | CS/C(=N\c1ccccc1-c1ccc(OC(F)(F)F)cc1)NC#N |
| InChI | InChI=1S/C16H12F3N3OS/c1-24-15(21-10-20)22-14-5-3-2-4-13(14)11-6-8-12(9-7-11)23-16(17,18)19/h2-9H,1H3,(H,21,22) |
| InChIKey | QYPJEPASVFFOTM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 57.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|