C19H21N3S — CID 169360690
methyl N'-(4-tert-butyl-2-phenylphenyl)-N-cyanocarbamimidothioate (PubChem CID 169360690) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is methyl N'-(4-tert-butyl-2-phenylphenyl)-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-(4-tert-butyl-2-phenylphenyl)-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 169360690 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | methyl N'-(4-tert-butyl-2-phenylphenyl)-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1ccc(C(C)(C)C)cc1-c1ccccc1)NC#N |
| InChI | InChI=1S/C19H21N3S/c1-19(2,3)15-10-11-17(22-18(23-4)21-13-20)16(12-15)14-8-6-5-7-9-14/h5-12H,1-4H3,(H,21,22) |
| InChIKey | XSIKOONZLDAWKJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|